C29H29N3O — CID 10789018
4-[1-(4-cyano-4,4-diphenylbutyl)-4-hydroxypiperidin-4-yl]benzonitrile (PubChem CID 10789018) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[1-(4-cyano-4,4-diphenylbutyl)-4-hydroxypiperidin-4-yl]benzonitrile.
| Compound Name | 4-[1-(4-cyano-4,4-diphenylbutyl)-4-hydroxypiperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 10789018 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 4-[1-(4-cyano-4,4-diphenylbutyl)-4-hydroxypiperidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2(O)CCN(CCCC(C#N)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H29N3O/c30-22-24-12-14-27(15-13-24)29(33)17-20-32(21-18-29)19-7-16-28(23-31,25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-15,33H,7,16-21H2 |
| InChIKey | SMLYXACROHVGEK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |