C20H24ClNO — CID 10892851
4-(4-chlorophenyl)-1-(3-phenylpropyl)piperidin-4-ol (PubChem CID 10892851) has the molecular formula C20H24ClNO and a molecular weight of 329.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(3-phenylpropyl)piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-(3-phenylpropyl)piperidin-4-ol |
|---|---|
| PubChem CID | 10892851 |
| Molecular Formula | C20H24ClNO |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(3-phenylpropyl)piperidin-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24ClNO/c21-19-10-8-18(9-11-19)20(23)12-15-22(16-13-20)14-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-11,23H,4,7,12-16H2 |
| InChIKey | WFQAUBWSHNCWHT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |