C22H27ClN2O2 — CID 144925800
4-(4-chlorophenyl)-4-hydroxy-N-(4-phenylbutyl)piperidine-1-carboxamide (PubChem CID 144925800) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-hydroxy-N-(4-phenylbutyl)piperidine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-4-hydroxy-N-(4-phenylbutyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 144925800 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-(4-chlorophenyl)-4-hydroxy-N-(4-phenylbutyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O2/c23-20-11-9-19(10-12-20)22(27)13-16-25(17-14-22)21(26)24-15-5-4-8-18-6-2-1-3-7-18/h1-3,6-7,9-12,27H,4-5,8,13-17H2,(H,24,26) |
| InChIKey | FIZJFCRDSZYQAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|