C24H26ClN3O4 — CID 71701821
5-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 71701821) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is 5-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71701821 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 5-[2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(CC1NC(=O)N(CCc2ccccc2)C1=O)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H26ClN3O4/c25-19-8-6-18(7-9-19)24(32)11-14-27(15-12-24)21(29)16-20-22(30)28(23(31)26-20)13-10-17-4-2-1-3-5-17/h1-9,20,32H,10-16H2,(H,26,31) |
| InChIKey | SYPDMPCHUNTXCU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|