C28H29F2NO2 — CID 67820733
[2-fluoro-5-[4-hydroxy-1-(4-phenylbutyl)piperidin-4-yl]phenyl]-(4-fluorophenyl)methanone (PubChem CID 67820733) has the molecular formula C28H29F2NO2 and a molecular weight of 449.54 g/mol. Its IUPAC name is [2-fluoro-5-[4-hydroxy-1-(4-phenylbutyl)piperidin-4-yl]phenyl]-(4-fluorophenyl)methanone.
| Compound Name | [2-fluoro-5-[4-hydroxy-1-(4-phenylbutyl)piperidin-4-yl]phenyl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67820733 |
| Molecular Formula | C28H29F2NO2 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [2-fluoro-5-[4-hydroxy-1-(4-phenylbutyl)piperidin-4-yl]phenyl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1cc(C2(O)CCN(CCCCc3ccccc3)CC2)ccc1F |
| InChI | InChI=1S/C28H29F2NO2/c29-24-12-9-22(10-13-24)27(32)25-20-23(11-14-26(25)30)28(33)15-18-31(19-16-28)17-5-4-8-21-6-2-1-3-7-21/h1-3,6-7,9-14,20,33H,4-5,8,15-19H2 |
| InChIKey | DXPOPAOKLBLRJF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|