About bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride
bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride (PubChem CID 158147093) has the molecular formula C36H59ClN2O2
and a molecular weight of 587.33 g/mol. Its IUPAC name is bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride.
Molecular Properties
| Compound Name | bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride |
| PubChem CID | 158147093 |
| Molecular Formula | C36H59ClN2O2 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 586.43 |
| IUPAC Name | bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride |
| SMILES | Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cl |
| InChI | InChI=1S/2C18H29NO.ClH/c2*1-15-5-7-16(8-6-15)17(2,3)9-12-19-13-10-18(4,20)11-14-19;/h2*5-8,20H,9-14H2,1-4H3;1H |
| InChIKey | MWWMIGNQELDMBU-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride?
The IUPAC name of bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride (CID 158147093) is bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride.
What is the SMILES notation for bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride?
The canonical SMILES for bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride is Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cl.
What is the InChIKey of bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride?
The InChIKey is MWWMIGNQELDMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H29NO.ClH/c2*1-15-5-7-16(8-6-15)17(2,3)9-12-19-13-10-18(4,20)11-14-19;/h2*5-8,20H,9-14H2,1-4H3;1H.
What are the key properties of bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride?
bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride has a molecular weight of 587.33 g/mol, XLogP of 7.44, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride is sourced from PubChem (CID 158147093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).