C36H59ClN2O2 — CID 158147093
bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride (PubChem CID 158147093) has the molecular formula C36H59ClN2O2 and a molecular weight of 587.33 g/mol. Its IUPAC name is bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride.
| Compound Name | bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride |
|---|---|
| PubChem CID | 158147093 |
| Molecular Formula | C36H59ClN2O2 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 586.43 |
| IUPAC Name | bis(4-methyl-1-[3-methyl-3-(4-methylphenyl)butyl]piperidin-4-ol);hydrochloride |
| SMILES | Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cc1ccc(C(C)(C)CCN2CCC(C)(O)CC2)cc1.Cl |
| InChI | InChI=1S/2C18H29NO.ClH/c2*1-15-5-7-16(8-6-15)17(2,3)9-12-19-13-10-18(4,20)11-14-19;/h2*5-8,20H,9-14H2,1-4H3;1H |
| InChIKey | MWWMIGNQELDMBU-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |