C21H30F3N — CID 142475097
4-cyclobutyl-1-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]piperidine (PubChem CID 142475097) has the molecular formula C21H30F3N and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-cyclobutyl-1-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]piperidine.
| Compound Name | 4-cyclobutyl-1-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]piperidine |
|---|---|
| PubChem CID | 142475097 |
| Molecular Formula | C21H30F3N |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 4-cyclobutyl-1-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]piperidine |
| SMILES | CC(C)(CCN1CCC(C2CCC2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H30F3N/c1-20(2,18-6-8-19(9-7-18)21(22,23)24)12-15-25-13-10-17(11-14-25)16-4-3-5-16/h6-9,16-17H,3-5,10-15H2,1-2H3 |
| InChIKey | SOQXWCBTHSVCJV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |