C21H32ClNO — CID 142475420
1-[3-(4-chlorophenyl)-3-methylbutyl]-4-(oxan-4-yl)piperidine (PubChem CID 142475420) has the molecular formula C21H32ClNO and a molecular weight of 349.95 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-3-methylbutyl]-4-(oxan-4-yl)piperidine.
| Compound Name | 1-[3-(4-chlorophenyl)-3-methylbutyl]-4-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 142475420 |
| Molecular Formula | C21H32ClNO |
| Molecular Weight | 349.95 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-3-methylbutyl]-4-(oxan-4-yl)piperidine |
| SMILES | CC(C)(CCN1CCC(C2CCOCC2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H32ClNO/c1-21(2,19-3-5-20(22)6-4-19)11-14-23-12-7-17(8-13-23)18-9-15-24-16-10-18/h3-6,17-18H,7-16H2,1-2H3 |
| InChIKey | QLTUTBFAFXZWTM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |