C18H28ClNO2 — CID 34686638
(3R)-3-(4-chlorophenyl)-6-methyl-1-morpholin-4-ylheptan-3-ol (PubChem CID 34686638) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-6-methyl-1-morpholin-4-ylheptan-3-ol.
| Compound Name | (3R)-3-(4-chlorophenyl)-6-methyl-1-morpholin-4-ylheptan-3-ol |
|---|---|
| PubChem CID | 34686638 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-6-methyl-1-morpholin-4-ylheptan-3-ol |
| SMILES | CC(C)CC[C@@](O)(CCN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H28ClNO2/c1-15(2)7-8-18(21,16-3-5-17(19)6-4-16)9-10-20-11-13-22-14-12-20/h3-6,15,21H,7-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | UJRBNYNJUHBHGB-GOSISDBHSA-N |
| XLogP | 3.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |