C25H38ClNO — CID 142475199
1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(oxan-4-yl)piperidine (PubChem CID 142475199) has the molecular formula C25H38ClNO and a molecular weight of 404.04 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(oxan-4-yl)piperidine.
| Compound Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 142475199 |
| Molecular Formula | C25H38ClNO |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(oxan-4-yl)piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC(C2CCOCC2)CC1 |
| InChI | InChI=1S/C25H38ClNO/c1-19(2)17-24(18-25(3,4)22-5-7-23(26)8-6-22)27-13-9-20(10-14-27)21-11-15-28-16-12-21/h5-8,17,20-21,24H,9-16,18H2,1-4H3 |
| InChIKey | CHFBVKPZDCHUEI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|