About 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine
1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine (PubChem CID 142475394) has the molecular formula C24H39NO
and a molecular weight of 357.58 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine |
| PubChem CID | 142475394 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine |
| SMILES | COc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H39NO/c1-18(2)16-22(25-14-12-20(13-15-25)19(3)4)17-24(5,6)21-8-10-23(26-7)11-9-21/h8-11,16,19-20,22H,12-15,17H2,1-7H3 |
| InChIKey | PEGJVKYZQVJINL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine?
The IUPAC name of 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine (CID 142475394) is 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine.
What is the SMILES notation for 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine?
The canonical SMILES for 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine is COc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(C(C)C)CC2)cc1.
What is the InChIKey of 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine?
The InChIKey is PEGJVKYZQVJINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H39NO/c1-18(2)16-22(25-14-12-20(13-15-25)19(3)4)17-24(5,6)21-8-10-23(26-7)11-9-21/h8-11,16,19-20,22H,12-15,17H2,1-7H3.
What are the key properties of 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine?
1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine has a molecular weight of 357.58 g/mol, XLogP of 6.07, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine is sourced from PubChem (CID 142475394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).