C24H39NO — CID 142475394
1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine (PubChem CID 142475394) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine.
| Compound Name | 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 142475394 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-4-propan-2-ylpiperidine |
| SMILES | COc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H39NO/c1-18(2)16-22(25-14-12-20(13-15-25)19(3)4)17-24(5,6)21-8-10-23(26-7)11-9-21/h8-11,16,19-20,22H,12-15,17H2,1-7H3 |
| InChIKey | PEGJVKYZQVJINL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|