C26H39F3N2 — CID 142475098
1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-piperidin-1-ylpiperidine (PubChem CID 142475098) has the molecular formula C26H39F3N2 and a molecular weight of 436.61 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-piperidin-1-ylpiperidine.
| Compound Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 142475098 |
| Molecular Formula | C26H39F3N2 |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-[2,6-dimethyl-6-[4-(trifluoromethyl)phenyl]hept-2-en-4-yl]-4-piperidin-1-ylpiperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(C(F)(F)F)cc1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C26H39F3N2/c1-20(2)18-24(31-16-12-23(13-17-31)30-14-6-5-7-15-30)19-25(3,4)21-8-10-22(11-9-21)26(27,28)29/h8-11,18,23-24H,5-7,12-17,19H2,1-4H3 |
| InChIKey | QPLVKGBOUCBXSL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|