C25H39FN2O — CID 163403193
cyclopropyl-[4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazin-1-yl]methanone;ethane (PubChem CID 163403193) has the molecular formula C25H39FN2O and a molecular weight of 402.60 g/mol. Its IUPAC name is cyclopropyl-[4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazin-1-yl]methanone;ethane.
| Compound Name | cyclopropyl-[4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazin-1-yl]methanone;ethane |
|---|---|
| PubChem CID | 163403193 |
| Molecular Formula | C25H39FN2O |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | cyclopropyl-[4-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]piperazin-1-yl]methanone;ethane |
| SMILES | CC.CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C23H33FN2O.C2H6/c1-17(2)15-21(16-23(3,4)19-7-9-20(24)10-8-19)25-11-13-26(14-12-25)22(27)18-5-6-18;1-2/h7-10,15,18,21H,5-6,11-14,16H2,1-4H3;1-2H3 |
| InChIKey | BGJGDKAIQATOGO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|