C21H29FN2O2S — CID 142475375
methyl 4-[6-(4-fluorophenyl)-2,6-dimethyl-7-sulfanylidenehept-2-en-4-yl]piperazine-1-carboxylate (PubChem CID 142475375) has the molecular formula C21H29FN2O2S and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl 4-[6-(4-fluorophenyl)-2,6-dimethyl-7-sulfanylidenehept-2-en-4-yl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[6-(4-fluorophenyl)-2,6-dimethyl-7-sulfanylidenehept-2-en-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142475375 |
| Molecular Formula | C21H29FN2O2S |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | methyl 4-[6-(4-fluorophenyl)-2,6-dimethyl-7-sulfanylidenehept-2-en-4-yl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(C=C(C)C)CC(C)(C=S)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H29FN2O2S/c1-16(2)13-19(23-9-11-24(12-10-23)20(25)26-4)14-21(3,15-27)17-5-7-18(22)8-6-17/h5-8,13,15,19H,9-12,14H2,1-4H3 |
| InChIKey | SWJFIKUOHAOGFT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|