C22H31FN4O2 — CID 123233975
tert-butyl 4-[1-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]ethyl]piperazine-1-carboxylate (PubChem CID 123233975) has the molecular formula C22H31FN4O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123233975 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | tert-butyl 4-[1-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]ethyl]piperazine-1-carboxylate |
| SMILES | CC(c1cncn1C(C)c1ccc(F)cc1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H31FN4O2/c1-16(18-6-8-19(23)9-7-18)27-15-24-14-20(27)17(2)25-10-12-26(13-11-25)21(28)29-22(3,4)5/h6-9,14-17H,10-13H2,1-5H3 |
| InChIKey | VQJHLQNDPHLRPS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |