C24H30FN3O3 — CID 171716497
tert-butyl 4-[1-(4-fluorophenyl)-2-(4-methylanilino)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 171716497) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-fluorophenyl)-2-(4-methylanilino)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-fluorophenyl)-2-(4-methylanilino)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171716497 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | tert-butyl 4-[1-(4-fluorophenyl)-2-(4-methylanilino)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C(c2ccc(F)cc2)N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H30FN3O3/c1-17-5-11-20(12-6-17)26-22(29)21(18-7-9-19(25)10-8-18)27-13-15-28(16-14-27)23(30)31-24(2,3)4/h5-12,21H,13-16H2,1-4H3,(H,26,29) |
| InChIKey | ROLWMRCUIKTZQQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |