C23H29FN4O4 — CID 123664803
tert-butyl 4-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]-3-oxo-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 123664803) has the molecular formula C23H29FN4O4 and a molecular weight of 444.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]-3-oxo-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]-3-oxo-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 123664803 |
| Molecular Formula | C23H29FN4O4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | tert-butyl 4-[3-[1-(4-fluorophenyl)ethyl]imidazol-4-yl]-3-oxo-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | CC(c1ccc(F)cc1)n1cncc1C1C(=O)OCC2CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C23H29FN4O4/c1-15(16-5-7-17(24)8-6-16)28-14-25-11-19(28)20-21(29)31-13-18-12-26(9-10-27(18)20)22(30)32-23(2,3)4/h5-8,11,14-15,18,20H,9-10,12-13H2,1-4H3 |
| InChIKey | OSYLEUKCWCKJCI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |