C17H25N3O3 — CID 108884940
methyl 4-[(4-tert-butylphenyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 108884940) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 4-[(4-tert-butylphenyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(4-tert-butylphenyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108884940 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | methyl 4-[(4-tert-butylphenyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)13-5-7-14(8-6-13)18-15(21)19-9-11-20(12-10-19)16(22)23-4/h5-8H,9-12H2,1-4H3,(H,18,21) |
| InChIKey | ZGYPAMDKBGPQHO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |