C30H41ClN2 — CID 158792261
1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(3-pyrrolidin-1-ylphenyl)piperidine (PubChem CID 158792261) has the molecular formula C30H41ClN2 and a molecular weight of 465.13 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(3-pyrrolidin-1-ylphenyl)piperidine.
| Compound Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(3-pyrrolidin-1-ylphenyl)piperidine |
|---|---|
| PubChem CID | 158792261 |
| Molecular Formula | C30H41ClN2 |
| Molecular Weight | 465.13 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(3-pyrrolidin-1-ylphenyl)piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC(c2cccc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C30H41ClN2/c1-23(2)20-29(22-30(3,4)26-10-12-27(31)13-11-26)33-18-14-24(15-19-33)25-8-7-9-28(21-25)32-16-5-6-17-32/h7-13,20-21,24,29H,5-6,14-19,22H2,1-4H3 |
| InChIKey | AWBZMJGWKZZMQB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.13 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|