C18H27N — CID 141117958
1-[3-(4,4-dimethylcyclohexyl)phenyl]pyrrolidine (PubChem CID 141117958) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-[3-(4,4-dimethylcyclohexyl)phenyl]pyrrolidine.
| Compound Name | 1-[3-(4,4-dimethylcyclohexyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 141117958 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-[3-(4,4-dimethylcyclohexyl)phenyl]pyrrolidine |
| SMILES | CC1(C)CCC(c2cccc(N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C18H27N/c1-18(2)10-8-15(9-11-18)16-6-5-7-17(14-16)19-12-3-4-13-19/h5-7,14-15H,3-4,8-13H2,1-2H3 |
| InChIKey | DFJWEZQNXKZASA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |