C16H22N2O — CID 163230241
3,4,4-trimethyl-1-(3-pyrrolidin-1-ylphenyl)azetidin-2-one (PubChem CID 163230241) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-(3-pyrrolidin-1-ylphenyl)azetidin-2-one.
| Compound Name | 3,4,4-trimethyl-1-(3-pyrrolidin-1-ylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 163230241 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3,4,4-trimethyl-1-(3-pyrrolidin-1-ylphenyl)azetidin-2-one |
| SMILES | CC1C(=O)N(c2cccc(N3CCCC3)c2)C1(C)C |
| InChI | InChI=1S/C16H22N2O/c1-12-15(19)18(16(12,2)3)14-8-6-7-13(11-14)17-9-4-5-10-17/h6-8,11-12H,4-5,9-10H2,1-3H3 |
| InChIKey | IGSUTQUJTQJFQQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |