C29H42N2 — CID 156851276
1-(3-cyclopropyl-5-propan-2-ylphenyl)pyrrolidine;1-(3-propan-2-ylphenyl)pyrrolidine (PubChem CID 156851276) has the molecular formula C29H42N2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 1-(3-cyclopropyl-5-propan-2-ylphenyl)pyrrolidine;1-(3-propan-2-ylphenyl)pyrrolidine.
| Compound Name | 1-(3-cyclopropyl-5-propan-2-ylphenyl)pyrrolidine;1-(3-propan-2-ylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 156851276 |
| Molecular Formula | C29H42N2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 1-(3-cyclopropyl-5-propan-2-ylphenyl)pyrrolidine;1-(3-propan-2-ylphenyl)pyrrolidine |
| SMILES | CC(C)c1cc(C2CC2)cc(N2CCCC2)c1.CC(C)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C16H23N.C13H19N/c1-12(2)14-9-15(13-5-6-13)11-16(10-14)17-7-3-4-8-17;1-11(2)12-6-5-7-13(10-12)14-8-3-4-9-14/h9-13H,3-8H2,1-2H3;5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | WZYWRDNTWDUGJO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |