C20H30ClNO — CID 170659392
[(2R)-1-[(4S)-6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 170659392) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is [(2R)-1-[(4S)-6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[(4S)-6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 170659392 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | [(2R)-1-[(4S)-6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C20H30ClNO/c1-15(2)12-19(22-11-5-6-18(22)14-23)13-20(3,4)16-7-9-17(21)10-8-16/h7-10,12,18-19,23H,5-6,11,13-14H2,1-4H3/t18-,19?/m1/s1 |
| InChIKey | AHUZGWOESSDIQI-MRTLOADZSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|