C26H42N2 — CID 167693962
1-[2,6-dimethyl-6-(4-methylphenyl)hept-2-en-4-yl]-4-piperidin-4-ylpiperidine (PubChem CID 167693962) has the molecular formula C26H42N2 and a molecular weight of 382.64 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-(4-methylphenyl)hept-2-en-4-yl]-4-piperidin-4-ylpiperidine.
| Compound Name | 1-[2,6-dimethyl-6-(4-methylphenyl)hept-2-en-4-yl]-4-piperidin-4-ylpiperidine |
|---|---|
| PubChem CID | 167693962 |
| Molecular Formula | C26H42N2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | 1-[2,6-dimethyl-6-(4-methylphenyl)hept-2-en-4-yl]-4-piperidin-4-ylpiperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(C)cc1)N1CCC(C2CCNCC2)CC1 |
| InChI | InChI=1S/C26H42N2/c1-20(2)18-25(19-26(4,5)24-8-6-21(3)7-9-24)28-16-12-23(13-17-28)22-10-14-27-15-11-22/h6-9,18,22-23,25,27H,10-17,19H2,1-5H3 |
| InChIKey | SEDKARSQUQHOIP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|