C28H45NO2 — CID 142475126
9-[2,6-dimethyl-6-[4-[(2-methylpropan-2-yl)oxy]phenyl]hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 142475126) has the molecular formula C28H45NO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is 9-[2,6-dimethyl-6-[4-[(2-methylpropan-2-yl)oxy]phenyl]hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-[2,6-dimethyl-6-[4-[(2-methylpropan-2-yl)oxy]phenyl]hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142475126 |
| Molecular Formula | C28H45NO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | 9-[2,6-dimethyl-6-[4-[(2-methylpropan-2-yl)oxy]phenyl]hept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(OC(C)(C)C)cc1)N1CCC2(CCOCC2)CC1 |
| InChI | InChI=1S/C28H45NO2/c1-22(2)20-24(29-16-12-28(13-17-29)14-18-30-19-15-28)21-27(6,7)23-8-10-25(11-9-23)31-26(3,4)5/h8-11,20,24H,12-19,21H2,1-7H3 |
| InChIKey | GWPDRNXQRILTBP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|