C25H39NO2 — CID 142475275
9-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 142475275) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is 9-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142475275 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | 9-[6-(4-methoxyphenyl)-2,6-dimethylhept-2-en-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | COc1ccc(C(C)(C)CC(C=C(C)C)N2CCC3(CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C25H39NO2/c1-20(2)18-22(19-24(3,4)21-6-8-23(27-5)9-7-21)26-14-10-25(11-15-26)12-16-28-17-13-25/h6-9,18,22H,10-17,19H2,1-5H3 |
| InChIKey | JSCCBNOFXNPTLO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|