C29H48N2O — CID 158385109
1-[2,6-dimethyl-6-(4-piperidin-1-ylphenyl)hept-2-en-4-yl]-4-(3-methoxypropyl)piperidine (PubChem CID 158385109) has the molecular formula C29H48N2O and a molecular weight of 440.72 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-(4-piperidin-1-ylphenyl)hept-2-en-4-yl]-4-(3-methoxypropyl)piperidine.
| Compound Name | 1-[2,6-dimethyl-6-(4-piperidin-1-ylphenyl)hept-2-en-4-yl]-4-(3-methoxypropyl)piperidine |
|---|---|
| PubChem CID | 158385109 |
| Molecular Formula | C29H48N2O |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | 1-[2,6-dimethyl-6-(4-piperidin-1-ylphenyl)hept-2-en-4-yl]-4-(3-methoxypropyl)piperidine |
| SMILES | COCCCC1CCN(C(C=C(C)C)CC(C)(C)c2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C29H48N2O/c1-24(2)22-28(31-19-15-25(16-20-31)10-9-21-32-5)23-29(3,4)26-11-13-27(14-12-26)30-17-7-6-8-18-30/h11-14,22,25,28H,6-10,15-21,23H2,1-5H3 |
| InChIKey | RSWPJEYZJCHDJG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|