C22H35NO2 — CID 158682800
4-(3-methoxypropyl)-1-[4-methyl-1-(4-methylphenoxy)pent-3-en-2-yl]piperidine (PubChem CID 158682800) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-1-[4-methyl-1-(4-methylphenoxy)pent-3-en-2-yl]piperidine.
| Compound Name | 4-(3-methoxypropyl)-1-[4-methyl-1-(4-methylphenoxy)pent-3-en-2-yl]piperidine |
|---|---|
| PubChem CID | 158682800 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 4-(3-methoxypropyl)-1-[4-methyl-1-(4-methylphenoxy)pent-3-en-2-yl]piperidine |
| SMILES | COCCCC1CCN(C(C=C(C)C)COc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C22H35NO2/c1-18(2)16-21(17-25-22-9-7-19(3)8-10-22)23-13-11-20(12-14-23)6-5-15-24-4/h7-10,16,20-21H,5-6,11-15,17H2,1-4H3 |
| InChIKey | UMFOJSDZVITHPJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|