C13H20O3 — CID 117236908
4-methoxy-2-[(4-methylphenoxy)methyl]butan-1-ol (PubChem CID 117236908) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-methoxy-2-[(4-methylphenoxy)methyl]butan-1-ol.
| Compound Name | 4-methoxy-2-[(4-methylphenoxy)methyl]butan-1-ol |
|---|---|
| PubChem CID | 117236908 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-methoxy-2-[(4-methylphenoxy)methyl]butan-1-ol |
| SMILES | COCCC(CO)COc1ccc(C)cc1 |
| InChI | InChI=1S/C13H20O3/c1-11-3-5-13(6-4-11)16-10-12(9-14)7-8-15-2/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | WZIAWUKTQMNHFL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |