C12H15F3O3 — CID 117236902
2-[[4-(trifluoromethyl)phenoxy]methyl]butane-1,4-diol (PubChem CID 117236902) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenoxy]methyl]butane-1,4-diol.
| Compound Name | 2-[[4-(trifluoromethyl)phenoxy]methyl]butane-1,4-diol |
|---|---|
| PubChem CID | 117236902 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenoxy]methyl]butane-1,4-diol |
| SMILES | OCCC(CO)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O3/c13-12(14,15)10-1-3-11(4-2-10)18-8-9(7-17)5-6-16/h1-4,9,16-17H,5-8H2 |
| InChIKey | OWMJROCROLBHTI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |