C15H21F3O2 — CID 117241893
4,4-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]pentan-1-ol (PubChem CID 117241893) has the molecular formula C15H21F3O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]pentan-1-ol.
| Compound Name | 4,4-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]pentan-1-ol |
|---|---|
| PubChem CID | 117241893 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4,4-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]pentan-1-ol |
| SMILES | CC(C)(C)CC(CO)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3O2/c1-14(2,3)8-11(9-19)10-20-13-6-4-5-12(7-13)15(16,17)18/h4-7,11,19H,8-10H2,1-3H3 |
| InChIKey | AEKUPCRZDCSBBU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |