C12H13F3O2 — CID 58289073
(E,2R)-1-[3-(trifluoromethyl)phenoxy]pent-3-en-2-ol (PubChem CID 58289073) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (E,2R)-1-[3-(trifluoromethyl)phenoxy]pent-3-en-2-ol.
| Compound Name | (E,2R)-1-[3-(trifluoromethyl)phenoxy]pent-3-en-2-ol |
|---|---|
| PubChem CID | 58289073 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (E,2R)-1-[3-(trifluoromethyl)phenoxy]pent-3-en-2-ol |
| SMILES | C/C=C/[C@@H](O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O2/c1-2-4-10(16)8-17-11-6-3-5-9(7-11)12(13,14)15/h2-7,10,16H,8H2,1H3/b4-2+/t10-/m1/s1 |
| InChIKey | PLCKWPJGWUUEHE-XCRNYIDWSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|