C17H21F3O4 — CID 71157349
(1S,3R,4R,5R)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-methylcyclopentane-1,3-diol (PubChem CID 71157349) has the molecular formula C17H21F3O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-methylcyclopentane-1,3-diol.
| Compound Name | (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-methylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 71157349 |
| Molecular Formula | C17H21F3O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-5-methylcyclopentane-1,3-diol |
| SMILES | C[C@@H]1[C@@H](/C=C/[C@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C17H21F3O4/c1-10-14(16(23)8-15(10)22)6-5-12(21)9-24-13-4-2-3-11(7-13)17(18,19)20/h2-7,10,12,14-16,21-23H,8-9H2,1H3/b6-5+/t10-,12+,14-,15+,16-/m1/s1 |
| InChIKey | ZNIKDWKWXRYMOC-DFOMVWSESA-N |
| XLogP | 2.38 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|