C17H19F3O3 — CID 162589060
cis-(1R,3S)-3-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-4-methylidenecyclopentan-1-ol (PubChem CID 162589060) has the molecular formula C17H19F3O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-4-methylidenecyclopentan-1-ol.
| Compound Name | cis-(1R,3S)-3-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-4-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 162589060 |
| Molecular Formula | C17H19F3O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | cis-(1R,3S)-3-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-4-methylidenecyclopentan-1-ol |
| SMILES | C=C1C[C@H](O)C[C@H]1/C=C/[C@@H](O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3O3/c1-11-7-15(22)8-12(11)5-6-14(21)10-23-16-4-2-3-13(9-16)17(18,19)20/h2-6,9,12,14-15,21-22H,1,7-8,10H2/b6-5+/t12-,14-,15+/m1/s1 |
| InChIKey | HORCNYUGIUCXMQ-ZBRHRRKMSA-N |
| XLogP | 3.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|