C24H29F3O4 — CID 123330690
(2R,3R,3aS,11aR)-2-hydroxy-3-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one (PubChem CID 123330690) has the molecular formula C24H29F3O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is (2R,3R,3aS,11aR)-2-hydroxy-3-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one.
| Compound Name | (2R,3R,3aS,11aR)-2-hydroxy-3-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
|---|---|
| PubChem CID | 123330690 |
| Molecular Formula | C24H29F3O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2R,3R,3aS,11aR)-2-hydroxy-3-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
| SMILES | O=C1CCCC=CC[C@H]2[C@@H](C1)C[C@@H](O)[C@@H]2C=C[C@@H](O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H29F3O4/c25-24(26,27)17-6-5-8-20(14-17)31-15-19(29)10-11-22-21-9-4-2-1-3-7-18(28)12-16(21)13-23(22)30/h2,4-6,8,10-11,14,16,19,21-23,29-30H,1,3,7,9,12-13,15H2/t16-,19+,21-,22+,23+/m0/s1 |
| InChIKey | XMXVWDKEYRDVOW-JZALWMPUSA-N |
| XLogP | 4.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|