C23H27F3O5 — CID 90933655
(4S,14S,16R)-14,16-dihydroxy-4-[[3-(trifluoromethyl)phenoxy]methyl]-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-6-one (PubChem CID 90933655) has the molecular formula C23H27F3O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is (4S,14S,16R)-14,16-dihydroxy-4-[[3-(trifluoromethyl)phenoxy]methyl]-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-6-one.
| Compound Name | (4S,14S,16R)-14,16-dihydroxy-4-[[3-(trifluoromethyl)phenoxy]methyl]-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-6-one |
|---|---|
| PubChem CID | 90933655 |
| Molecular Formula | C23H27F3O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (4S,14S,16R)-14,16-dihydroxy-4-[[3-(trifluoromethyl)phenoxy]methyl]-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-6-one |
| SMILES | O=C1CCCC=CCC2C(C=C[C@@H](COc3cccc(C(F)(F)F)c3)O1)[C@H](O)C[C@@H]2O |
| InChI | InChI=1S/C23H27F3O5/c24-23(25,26)15-6-5-7-16(12-15)30-14-17-10-11-19-18(20(27)13-21(19)28)8-3-1-2-4-9-22(29)31-17/h1,3,5-7,10-12,17-21,27-28H,2,4,8-9,13-14H2/t17-,18?,19?,20-,21+/m0/s1 |
| InChIKey | MCSHGKULSYQLJU-LHBDJYESSA-N |
| XLogP | 4.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|