C24H32O3 — CID 134590906
(2R,3R,3aS,5Z,11aR)-2-hydroxy-3-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one (PubChem CID 134590906) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one.
| Compound Name | (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
|---|---|
| PubChem CID | 134590906 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
| SMILES | O=C1CCC/C=C\C[C@H]2[C@@H](C1)C[C@@H](O)[C@@H]2/C=C/[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C24H32O3/c25-20(13-12-18-8-4-3-5-9-18)14-15-23-22-11-7-2-1-6-10-21(26)16-19(22)17-24(23)27/h2-5,7-9,14-15,19-20,22-25,27H,1,6,10-13,16-17H2/b7-2-,15-14+/t19-,20-,22-,23+,24+/m0/s1 |
| InChIKey | FMDJSGIVEANWDM-BZKCICEOSA-N |
| XLogP | 4.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|