C18H24O5 — CID 148846294
2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]acetic acid (PubChem CID 148846294) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 148846294 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C18H24O5/c19-13(7-6-12-4-2-1-3-5-12)8-9-14-15(10-18(22)23)17(21)11-16(14)20/h1-5,8-9,13-17,19-21H,6-7,10-11H2,(H,22,23)/b9-8+/t13-,14+,15+,16+,17-/m0/s1 |
| InChIKey | OWNPMDPXSXXKJT-RKCGEVCRSA-N |
| XLogP | 1.37 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|