C16H20O3 — CID 90305551
trans-(3S,4S)-3-hydroxy-4-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentan-1-one (PubChem CID 90305551) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is trans-(3S,4S)-3-hydroxy-4-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(3S,4S)-3-hydroxy-4-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 90305551 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | trans-(3S,4S)-3-hydroxy-4-[(E,3R)-3-hydroxy-5-phenylpent-1-enyl]cyclopentan-1-one |
| SMILES | O=C1C[C@@H](/C=C/[C@H](O)CCc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C16H20O3/c17-14(8-6-12-4-2-1-3-5-12)9-7-13-10-15(18)11-16(13)19/h1-5,7,9,13-14,16-17,19H,6,8,10-11H2/b9-7+/t13-,14-,16+/m1/s1 |
| InChIKey | VYBLEKVMINSETJ-DJRJSVGISA-N |
| XLogP | 1.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|