C16H22O — CID 10263265
(E)-1-cyclopentyl-5-phenylpent-1-en-3-ol (PubChem CID 10263265) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (E)-1-cyclopentyl-5-phenylpent-1-en-3-ol.
| Compound Name | (E)-1-cyclopentyl-5-phenylpent-1-en-3-ol |
|---|---|
| PubChem CID | 10263265 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (E)-1-cyclopentyl-5-phenylpent-1-en-3-ol |
| SMILES | OC(/C=C/C1CCCC1)CCc1ccccc1 |
| InChI | InChI=1S/C16H22O/c17-16(13-11-15-8-4-5-9-15)12-10-14-6-2-1-3-7-14/h1-3,6-7,11,13,15-17H,4-5,8-10,12H2/b13-11+ |
| InChIKey | QZQBESXRNMFCLQ-ACCUITESSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|