C17H24 — CID 11138907
[(E,2S)-4-cyclohexyl-2-methylbut-3-enyl]benzene (PubChem CID 11138907) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is [(E,2S)-4-cyclohexyl-2-methylbut-3-enyl]benzene.
| Compound Name | [(E,2S)-4-cyclohexyl-2-methylbut-3-enyl]benzene |
|---|---|
| PubChem CID | 11138907 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | [(E,2S)-4-cyclohexyl-2-methylbut-3-enyl]benzene |
| SMILES | C[C@H](/C=C/C1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C17H24/c1-15(14-17-10-6-3-7-11-17)12-13-16-8-4-2-5-9-16/h3,6-7,10-13,15-16H,2,4-5,8-9,14H2,1H3/b13-12+/t15-/m1/s1 |
| InChIKey | YLZNZBCSYNWOLU-RDRICISKSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|