C18H28 — CID 54237378
[2-(cyclohexylmethyl)-3-methylbutyl]benzene (PubChem CID 54237378) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is [2-(cyclohexylmethyl)-3-methylbutyl]benzene.
| Compound Name | [2-(cyclohexylmethyl)-3-methylbutyl]benzene |
|---|---|
| PubChem CID | 54237378 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | [2-(cyclohexylmethyl)-3-methylbutyl]benzene |
| SMILES | CC(C)C(Cc1ccccc1)CC1CCCCC1 |
| InChI | InChI=1S/C18H28/c1-15(2)18(13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17/h3,5-6,9-10,15,17-18H,4,7-8,11-14H2,1-2H3 |
| InChIKey | ANUOLQVCRCUUAT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |