C23H32 — CID 57064736
2-[2-(cyclohexylmethyl)-3-methylpentyl]naphthalene (PubChem CID 57064736) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-[2-(cyclohexylmethyl)-3-methylpentyl]naphthalene.
| Compound Name | 2-[2-(cyclohexylmethyl)-3-methylpentyl]naphthalene |
|---|---|
| PubChem CID | 57064736 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2-[2-(cyclohexylmethyl)-3-methylpentyl]naphthalene |
| SMILES | CCC(C)C(Cc1ccc2ccccc2c1)CC1CCCCC1 |
| InChI | InChI=1S/C23H32/c1-3-18(2)23(15-19-9-5-4-6-10-19)17-20-13-14-21-11-7-8-12-22(21)16-20/h7-8,11-14,16,18-19,23H,3-6,9-10,15,17H2,1-2H3 |
| InChIKey | LMDUBYLKHBNZNP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |