C14H16O2 — CID 20647932
2-methyl-3-naphthalen-2-ylpropane-1,1-diol (PubChem CID 20647932) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-methyl-3-naphthalen-2-ylpropane-1,1-diol.
| Compound Name | 2-methyl-3-naphthalen-2-ylpropane-1,1-diol |
|---|---|
| PubChem CID | 20647932 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-methyl-3-naphthalen-2-ylpropane-1,1-diol |
| SMILES | CC(Cc1ccc2ccccc2c1)C(O)O |
| InChI | InChI=1S/C14H16O2/c1-10(14(15)16)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-7,9-10,14-16H,8H2,1H3 |
| InChIKey | DBGRQJMQLJMHRH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|