C26H28O2 — CID 166677264
3-methyl-4-[3-(3-methyl-2-oxobutyl)phenyl]-1-naphthalen-2-ylbutan-2-one (PubChem CID 166677264) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-methyl-4-[3-(3-methyl-2-oxobutyl)phenyl]-1-naphthalen-2-ylbutan-2-one.
| Compound Name | 3-methyl-4-[3-(3-methyl-2-oxobutyl)phenyl]-1-naphthalen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 166677264 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 3-methyl-4-[3-(3-methyl-2-oxobutyl)phenyl]-1-naphthalen-2-ylbutan-2-one |
| SMILES | CC(C)C(=O)Cc1cccc(CC(C)C(=O)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C26H28O2/c1-18(2)25(27)16-21-8-6-7-20(14-21)13-19(3)26(28)17-22-11-12-23-9-4-5-10-24(23)15-22/h4-12,14-15,18-19H,13,16-17H2,1-3H3 |
| InChIKey | WBUPMHXAGLPZPJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |