C24H27NO4 — CID 162079846
(3R)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-4-naphthalen-2-ylbutan-2-one;formic acid (PubChem CID 162079846) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (3R)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-4-naphthalen-2-ylbutan-2-one;formic acid.
| Compound Name | (3R)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-4-naphthalen-2-ylbutan-2-one;formic acid |
|---|---|
| PubChem CID | 162079846 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (3R)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-4-naphthalen-2-ylbutan-2-one;formic acid |
| SMILES | C[C@H](Cc1ccc2ccccc2c1)C(=O)COCc1ccc(CN)cc1.O=CO |
| InChI | InChI=1S/C23H25NO2.CH2O2/c1-17(12-20-10-11-21-4-2-3-5-22(21)13-20)23(25)16-26-15-19-8-6-18(14-24)7-9-19;2-1-3/h2-11,13,17H,12,14-16,24H2,1H3;1H,(H,2,3)/t17-;/m1./s1 |
| InChIKey | ZCEPHLAABWKMRE-UNTBIKODSA-N |
| XLogP | 3.96 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|