C19H25NO2 — CID 156677951
propan-2-yl 3-naphthalen-2-yl-2-(propan-2-ylamino)propanoate (PubChem CID 156677951) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is propan-2-yl 3-naphthalen-2-yl-2-(propan-2-ylamino)propanoate.
| Compound Name | propan-2-yl 3-naphthalen-2-yl-2-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 156677951 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | propan-2-yl 3-naphthalen-2-yl-2-(propan-2-ylamino)propanoate |
| SMILES | CC(C)NC(Cc1ccc2ccccc2c1)C(=O)OC(C)C |
| InChI | InChI=1S/C19H25NO2/c1-13(2)20-18(19(21)22-14(3)4)12-15-9-10-16-7-5-6-8-17(16)11-15/h5-11,13-14,18,20H,12H2,1-4H3 |
| InChIKey | AKRZOYDNGDUESP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |