C21H27NO4 — CID 157247100
(3S)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-5-phenylpentan-2-one;formic acid (PubChem CID 157247100) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3S)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-5-phenylpentan-2-one;formic acid.
| Compound Name | (3S)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-5-phenylpentan-2-one;formic acid |
|---|---|
| PubChem CID | 157247100 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (3S)-1-[[4-(aminomethyl)phenyl]methoxy]-3-methyl-5-phenylpentan-2-one;formic acid |
| SMILES | C[C@@H](CCc1ccccc1)C(=O)COCc1ccc(CN)cc1.O=CO |
| InChI | InChI=1S/C20H25NO2.CH2O2/c1-16(7-8-17-5-3-2-4-6-17)20(22)15-23-14-19-11-9-18(13-21)10-12-19;2-1-3/h2-6,9-12,16H,7-8,13-15,21H2,1H3;1H,(H,2,3)/t16-;/m0./s1 |
| InChIKey | AVXHDMUZPFCVKU-NTISSMGPSA-N |
| XLogP | 3.20 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|