About acetaldehyde;2-cyclopentylpropylbenzene;ethane
acetaldehyde;2-cyclopentylpropylbenzene;ethane (PubChem CID 170581057) has the molecular formula C20H36O
and a molecular weight of 292.51 g/mol. Its IUPAC name is acetaldehyde;2-cyclopentylpropylbenzene;ethane.
Molecular Properties
| Compound Name | acetaldehyde;2-cyclopentylpropylbenzene;ethane |
| PubChem CID | 170581057 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | acetaldehyde;2-cyclopentylpropylbenzene;ethane |
| SMILES | CC.CC.CC(Cc1ccccc1)C1CCCC1.CC=O |
| InChI | InChI=1S/C14H20.C2H4O.2C2H6/c1-12(14-9-5-6-10-14)11-13-7-3-2-4-8-13;1-2-3;2*1-2/h2-4,7-8,12,14H,5-6,9-11H2,1H3;2H,1H3;2*1-2H3 |
| InChIKey | YNMWDRAAGYXOST-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;2-cyclopentylpropylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;2-cyclopentylpropylbenzene;ethane?
The IUPAC name of acetaldehyde;2-cyclopentylpropylbenzene;ethane (CID 170581057) is acetaldehyde;2-cyclopentylpropylbenzene;ethane.
What is the SMILES notation for acetaldehyde;2-cyclopentylpropylbenzene;ethane?
The canonical SMILES for acetaldehyde;2-cyclopentylpropylbenzene;ethane is CC.CC.CC(Cc1ccccc1)C1CCCC1.CC=O.
What is the InChIKey of acetaldehyde;2-cyclopentylpropylbenzene;ethane?
The InChIKey is YNMWDRAAGYXOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.C2H4O.2C2H6/c1-12(14-9-5-6-10-14)11-13-7-3-2-4-8-13;1-2-3;2*1-2/h2-4,7-8,12,14H,5-6,9-11H2,1H3;2H,1H3;2*1-2H3.
What are the key properties of acetaldehyde;2-cyclopentylpropylbenzene;ethane?
acetaldehyde;2-cyclopentylpropylbenzene;ethane has a molecular weight of 292.51 g/mol, XLogP of 6.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;2-cyclopentylpropylbenzene;ethane is sourced from PubChem (CID 170581057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).