C20H29NO2 — CID 143582761
trans-(1R,4R)-N-[(2R)-1-oxo-3-phenylpropan-2-yl]-4-propan-2-ylcycloheptane-1-carboxamide (PubChem CID 143582761) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is trans-(1R,4R)-N-[(2R)-1-oxo-3-phenylpropan-2-yl]-4-propan-2-ylcycloheptane-1-carboxamide.
| Compound Name | trans-(1R,4R)-N-[(2R)-1-oxo-3-phenylpropan-2-yl]-4-propan-2-ylcycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 143582761 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | trans-(1R,4R)-N-[(2R)-1-oxo-3-phenylpropan-2-yl]-4-propan-2-ylcycloheptane-1-carboxamide |
| SMILES | CC(C)[C@@H]1CCC[C@@H](C(=O)N[C@@H](C=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29NO2/c1-15(2)17-9-6-10-18(12-11-17)20(23)21-19(14-22)13-16-7-4-3-5-8-16/h3-5,7-8,14-15,17-19H,6,9-13H2,1-2H3,(H,21,23)/t17-,18-,19-/m1/s1 |
| InChIKey | FUARQWOORINGCN-GUDVDZBRSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|